C23H30N2S — CID 100765123
1-(3,5-dimethylphenyl)-3-[1-[2-(3-methylphenyl)ethyl]cyclopentyl]thiourea (PubChem CID 100765123) has the molecular formula C23H30N2S and a molecular weight of 366.57 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[1-[2-(3-methylphenyl)ethyl]cyclopentyl]thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[1-[2-(3-methylphenyl)ethyl]cyclopentyl]thiourea |
|---|---|
| PubChem CID | 100765123 |
| Molecular Formula | C23H30N2S |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[1-[2-(3-methylphenyl)ethyl]cyclopentyl]thiourea |
| SMILES | Cc1cccc(CCC2(NC(=S)Nc3cc(C)cc(C)c3)CCCC2)c1 |
| InChI | InChI=1S/C23H30N2S/c1-17-7-6-8-20(14-17)9-12-23(10-4-5-11-23)25-22(26)24-21-15-18(2)13-19(3)16-21/h6-8,13-16H,4-5,9-12H2,1-3H3,(H2,24,25,26) |
| InChIKey | SSMDZKMHMGCCLQ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|