C22H27ClN2OS — CID 100767770
1-(3-chloro-4-methoxyphenyl)-3-[1-[2-(3-methylphenyl)ethyl]cyclopentyl]thiourea (PubChem CID 100767770) has the molecular formula C22H27ClN2OS and a molecular weight of 402.99 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-[1-[2-(3-methylphenyl)ethyl]cyclopentyl]thiourea.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-[1-[2-(3-methylphenyl)ethyl]cyclopentyl]thiourea |
|---|---|
| PubChem CID | 100767770 |
| Molecular Formula | C22H27ClN2OS |
| Molecular Weight | 402.99 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-[1-[2-(3-methylphenyl)ethyl]cyclopentyl]thiourea |
| SMILES | COc1ccc(NC(=S)NC2(CCc3cccc(C)c3)CCCC2)cc1Cl |
| InChI | InChI=1S/C22H27ClN2OS/c1-16-6-5-7-17(14-16)10-13-22(11-3-4-12-22)25-21(27)24-18-8-9-20(26-2)19(23)15-18/h5-9,14-15H,3-4,10-13H2,1-2H3,(H2,24,25,27) |
| InChIKey | FXCROLQIONKFIA-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.99 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|