C18H20ClN3OS — CID 100767724
1-(3-chloro-4-methoxyphenyl)-3-(1-pyridin-4-ylcyclopentyl)thiourea (PubChem CID 100767724) has the molecular formula C18H20ClN3OS and a molecular weight of 361.90 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-(1-pyridin-4-ylcyclopentyl)thiourea.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-(1-pyridin-4-ylcyclopentyl)thiourea |
|---|---|
| PubChem CID | 100767724 |
| Molecular Formula | C18H20ClN3OS |
| Molecular Weight | 361.90 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-(1-pyridin-4-ylcyclopentyl)thiourea |
| SMILES | COc1ccc(NC(=S)NC2(c3ccncc3)CCCC2)cc1Cl |
| InChI | InChI=1S/C18H20ClN3OS/c1-23-16-5-4-14(12-15(16)19)21-17(24)22-18(8-2-3-9-18)13-6-10-20-11-7-13/h4-7,10-12H,2-3,8-9H2,1H3,(H2,21,22,24) |
| InChIKey | MJWFLEIPWZMUNQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.90 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|