C20H22ClN3O2S — CID 100770838
ethyl 2-chloro-4-[(1-pyridin-4-ylcyclopentyl)carbamothioylamino]benzoate (PubChem CID 100770838) has the molecular formula C20H22ClN3O2S and a molecular weight of 403.94 g/mol. Its IUPAC name is ethyl 2-chloro-4-[(1-pyridin-4-ylcyclopentyl)carbamothioylamino]benzoate.
| Compound Name | ethyl 2-chloro-4-[(1-pyridin-4-ylcyclopentyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100770838 |
| Molecular Formula | C20H22ClN3O2S |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | ethyl 2-chloro-4-[(1-pyridin-4-ylcyclopentyl)carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)NC2(c3ccncc3)CCCC2)cc1Cl |
| InChI | InChI=1S/C20H22ClN3O2S/c1-2-26-18(25)16-6-5-15(13-17(16)21)23-19(27)24-20(9-3-4-10-20)14-7-11-22-12-8-14/h5-8,11-13H,2-4,9-10H2,1H3,(H2,23,24,27) |
| InChIKey | VZUNMVUFOKUICE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|