C18H21N3OS — CID 100766059
1-(3-methoxyphenyl)-3-(1-pyridin-4-ylcyclopentyl)thiourea (PubChem CID 100766059) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-(1-pyridin-4-ylcyclopentyl)thiourea.
| Compound Name | 1-(3-methoxyphenyl)-3-(1-pyridin-4-ylcyclopentyl)thiourea |
|---|---|
| PubChem CID | 100766059 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-(1-pyridin-4-ylcyclopentyl)thiourea |
| SMILES | COc1cccc(NC(=S)NC2(c3ccncc3)CCCC2)c1 |
| InChI | InChI=1S/C18H21N3OS/c1-22-16-6-4-5-15(13-16)20-17(23)21-18(9-2-3-10-18)14-7-11-19-12-8-14/h4-8,11-13H,2-3,9-10H2,1H3,(H2,20,21,23) |
| InChIKey | KPUBKMMIFHNZHK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|