C21H24N2O3S — CID 100769976
methyl 3-[[1-(4-methoxyphenyl)cyclopentyl]carbamothioylamino]benzoate (PubChem CID 100769976) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is methyl 3-[[1-(4-methoxyphenyl)cyclopentyl]carbamothioylamino]benzoate.
| Compound Name | methyl 3-[[1-(4-methoxyphenyl)cyclopentyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100769976 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | methyl 3-[[1-(4-methoxyphenyl)cyclopentyl]carbamothioylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=S)NC2(c3ccc(OC)cc3)CCCC2)c1 |
| InChI | InChI=1S/C21H24N2O3S/c1-25-18-10-8-16(9-11-18)21(12-3-4-13-21)23-20(27)22-17-7-5-6-15(14-17)19(24)26-2/h5-11,14H,3-4,12-13H2,1-2H3,(H2,22,23,27) |
| InChIKey | PKZJUYNKFDAAAE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|