C20H23FN2OS — CID 100768099
1-[1-(4-ethoxyphenyl)cyclopentyl]-3-(3-fluorophenyl)thiourea (PubChem CID 100768099) has the molecular formula C20H23FN2OS and a molecular weight of 358.48 g/mol. Its IUPAC name is 1-[1-(4-ethoxyphenyl)cyclopentyl]-3-(3-fluorophenyl)thiourea.
| Compound Name | 1-[1-(4-ethoxyphenyl)cyclopentyl]-3-(3-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 100768099 |
| Molecular Formula | C20H23FN2OS |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-[1-(4-ethoxyphenyl)cyclopentyl]-3-(3-fluorophenyl)thiourea |
| SMILES | CCOc1ccc(C2(NC(=S)Nc3cccc(F)c3)CCCC2)cc1 |
| InChI | InChI=1S/C20H23FN2OS/c1-2-24-18-10-8-15(9-11-18)20(12-3-4-13-20)23-19(25)22-17-7-5-6-16(21)14-17/h5-11,14H,2-4,12-13H2,1H3,(H2,22,23,25) |
| InChIKey | HBSQDQDSPGESOX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|