C18H18ClFN2S — CID 100768085
1-[1-(2-chlorophenyl)cyclopentyl]-3-(3-fluorophenyl)thiourea (PubChem CID 100768085) has the molecular formula C18H18ClFN2S and a molecular weight of 348.87 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)cyclopentyl]-3-(3-fluorophenyl)thiourea.
| Compound Name | 1-[1-(2-chlorophenyl)cyclopentyl]-3-(3-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 100768085 |
| Molecular Formula | C18H18ClFN2S |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 1-[1-(2-chlorophenyl)cyclopentyl]-3-(3-fluorophenyl)thiourea |
| SMILES | Fc1cccc(NC(=S)NC2(c3ccccc3Cl)CCCC2)c1 |
| InChI | InChI=1S/C18H18ClFN2S/c19-16-9-2-1-8-15(16)18(10-3-4-11-18)22-17(23)21-14-7-5-6-13(20)12-14/h1-2,5-9,12H,3-4,10-11H2,(H2,21,22,23) |
| InChIKey | UDGICSHZOJODTQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|