C13H16FNO2 — CID 111430420
N-(3-fluorophenyl)-2-(1-hydroxycyclopentyl)acetamide (PubChem CID 111430420) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-(1-hydroxycyclopentyl)acetamide.
| Compound Name | N-(3-fluorophenyl)-2-(1-hydroxycyclopentyl)acetamide |
|---|---|
| PubChem CID | 111430420 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | N-(3-fluorophenyl)-2-(1-hydroxycyclopentyl)acetamide |
| SMILES | O=C(CC1(O)CCCC1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C13H16FNO2/c14-10-4-3-5-11(8-10)15-12(16)9-13(17)6-1-2-7-13/h3-5,8,17H,1-2,6-7,9H2,(H,15,16) |
| InChIKey | PYIXUYPMXXHHOW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |