C17H24FNO2 — CID 111538966
N-[1-(3-fluorophenyl)propan-2-yl]-2-(1-hydroxycyclohexyl)acetamide (PubChem CID 111538966) has the molecular formula C17H24FNO2 and a molecular weight of 293.38 g/mol. Its IUPAC name is N-[1-(3-fluorophenyl)propan-2-yl]-2-(1-hydroxycyclohexyl)acetamide.
| Compound Name | N-[1-(3-fluorophenyl)propan-2-yl]-2-(1-hydroxycyclohexyl)acetamide |
|---|---|
| PubChem CID | 111538966 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | N-[1-(3-fluorophenyl)propan-2-yl]-2-(1-hydroxycyclohexyl)acetamide |
| SMILES | CC(Cc1cccc(F)c1)NC(=O)CC1(O)CCCCC1 |
| InChI | InChI=1S/C17H24FNO2/c1-13(10-14-6-5-7-15(18)11-14)19-16(20)12-17(21)8-3-2-4-9-17/h5-7,11,13,21H,2-4,8-10,12H2,1H3,(H,19,20) |
| InChIKey | AWQXJKBYNZLIGT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |