C14H21FN2O2 — CID 99856761
1-[(2S)-1-(3-fluorophenyl)propan-2-yl]-3-[(2S)-1-hydroxybutan-2-yl]urea (PubChem CID 99856761) has the molecular formula C14H21FN2O2 and a molecular weight of 268.33 g/mol. Its IUPAC name is 1-[(2S)-1-(3-fluorophenyl)propan-2-yl]-3-[(2S)-1-hydroxybutan-2-yl]urea.
| Compound Name | 1-[(2S)-1-(3-fluorophenyl)propan-2-yl]-3-[(2S)-1-hydroxybutan-2-yl]urea |
|---|---|
| PubChem CID | 99856761 |
| Molecular Formula | C14H21FN2O2 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1-[(2S)-1-(3-fluorophenyl)propan-2-yl]-3-[(2S)-1-hydroxybutan-2-yl]urea |
| SMILES | CC[C@@H](CO)NC(=O)N[C@@H](C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C14H21FN2O2/c1-3-13(9-18)17-14(19)16-10(2)7-11-5-4-6-12(15)8-11/h4-6,8,10,13,18H,3,7,9H2,1-2H3,(H2,16,17,19)/t10-,13-/m0/s1 |
| InChIKey | SOUMGDMJUFITMU-GWCFXTLKSA-N |
| XLogP | 1.83 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |