C15H23FN2O2S — CID 111455614
1-[1-(3-fluorophenyl)propan-2-yl]-3-(4-hydroxy-1-methylsulfanylbutan-2-yl)urea (PubChem CID 111455614) has the molecular formula C15H23FN2O2S and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-[1-(3-fluorophenyl)propan-2-yl]-3-(4-hydroxy-1-methylsulfanylbutan-2-yl)urea.
| Compound Name | 1-[1-(3-fluorophenyl)propan-2-yl]-3-(4-hydroxy-1-methylsulfanylbutan-2-yl)urea |
|---|---|
| PubChem CID | 111455614 |
| Molecular Formula | C15H23FN2O2S |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1-[1-(3-fluorophenyl)propan-2-yl]-3-(4-hydroxy-1-methylsulfanylbutan-2-yl)urea |
| SMILES | CSCC(CCO)NC(=O)NC(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C15H23FN2O2S/c1-11(8-12-4-3-5-13(16)9-12)17-15(20)18-14(6-7-19)10-21-2/h3-5,9,11,14,19H,6-8,10H2,1-2H3,(H2,17,18,20) |
| InChIKey | XWAQJTGLCKDITE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |