C14H22FNS — CID 115719668
N-[1-(3-fluorophenyl)propan-2-yl]-2-methyl-3-methylsulfanylpropan-1-amine (PubChem CID 115719668) has the molecular formula C14H22FNS and a molecular weight of 255.40 g/mol. Its IUPAC name is N-[1-(3-fluorophenyl)propan-2-yl]-2-methyl-3-methylsulfanylpropan-1-amine.
| Compound Name | N-[1-(3-fluorophenyl)propan-2-yl]-2-methyl-3-methylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 115719668 |
| Molecular Formula | C14H22FNS |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | N-[1-(3-fluorophenyl)propan-2-yl]-2-methyl-3-methylsulfanylpropan-1-amine |
| SMILES | CSCC(C)CNC(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C14H22FNS/c1-11(10-17-3)9-16-12(2)7-13-5-4-6-14(15)8-13/h4-6,8,11-12,16H,7,9-10H2,1-3H3 |
| InChIKey | IVXQMLYXISNYOC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |