C17H22FNO3 — CID 119350665
1-[[4-(3-fluorophenyl)-3-methylbutanoyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 119350665) has the molecular formula C17H22FNO3 and a molecular weight of 307.36 g/mol. Its IUPAC name is 1-[[4-(3-fluorophenyl)-3-methylbutanoyl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[[4-(3-fluorophenyl)-3-methylbutanoyl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 119350665 |
| Molecular Formula | C17H22FNO3 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 1-[[4-(3-fluorophenyl)-3-methylbutanoyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | CC(CC(=O)NC1(C(=O)O)CCCC1)Cc1cccc(F)c1 |
| InChI | InChI=1S/C17H22FNO3/c1-12(9-13-5-4-6-14(18)11-13)10-15(20)19-17(16(21)22)7-2-3-8-17/h4-6,11-12H,2-3,7-10H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | YMCWKFXVHLTACB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |