C16H19FN2OS — CID 95906114
(3R)-N-[(3R)-3-cyanothiolan-3-yl]-4-(3-fluorophenyl)-3-methylbutanamide (PubChem CID 95906114) has the molecular formula C16H19FN2OS and a molecular weight of 306.41 g/mol. Its IUPAC name is (3R)-N-[(3R)-3-cyanothiolan-3-yl]-4-(3-fluorophenyl)-3-methylbutanamide.
| Compound Name | (3R)-N-[(3R)-3-cyanothiolan-3-yl]-4-(3-fluorophenyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 95906114 |
| Molecular Formula | C16H19FN2OS |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | (3R)-N-[(3R)-3-cyanothiolan-3-yl]-4-(3-fluorophenyl)-3-methylbutanamide |
| SMILES | C[C@@H](CC(=O)N[C@@]1(C#N)CCSC1)Cc1cccc(F)c1 |
| InChI | InChI=1S/C16H19FN2OS/c1-12(7-13-3-2-4-14(17)9-13)8-15(20)19-16(10-18)5-6-21-11-16/h2-4,9,12H,5-8,11H2,1H3,(H,19,20)/t12-,16-/m1/s1 |
| InChIKey | KPZOWANAEVBCAS-MLGOLLRUSA-N |
| XLogP | 2.91 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |