C13H12ClFN2OS — CID 94797656
2-(2-chloro-6-fluorophenyl)-N-[(3S)-3-cyanothiolan-3-yl]acetamide (PubChem CID 94797656) has the molecular formula C13H12ClFN2OS and a molecular weight of 298.77 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-[(3S)-3-cyanothiolan-3-yl]acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-[(3S)-3-cyanothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 94797656 |
| Molecular Formula | C13H12ClFN2OS |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-[(3S)-3-cyanothiolan-3-yl]acetamide |
| SMILES | N#C[C@@]1(NC(=O)Cc2c(F)cccc2Cl)CCSC1 |
| InChI | InChI=1S/C13H12ClFN2OS/c14-10-2-1-3-11(15)9(10)6-12(18)17-13(7-16)4-5-19-8-13/h1-3H,4-6,8H2,(H,17,18)/t13-/m0/s1 |
| InChIKey | YWOMALUJHDNDDG-ZDUSSCGKSA-N |
| XLogP | 2.54 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |