C14H14F2N2OS — CID 94817918
N-[(3R)-3-cyanothiolan-3-yl]-3-(2,5-difluorophenyl)propanamide (PubChem CID 94817918) has the molecular formula C14H14F2N2OS and a molecular weight of 296.34 g/mol. Its IUPAC name is N-[(3R)-3-cyanothiolan-3-yl]-3-(2,5-difluorophenyl)propanamide.
| Compound Name | N-[(3R)-3-cyanothiolan-3-yl]-3-(2,5-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 94817918 |
| Molecular Formula | C14H14F2N2OS |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-[(3R)-3-cyanothiolan-3-yl]-3-(2,5-difluorophenyl)propanamide |
| SMILES | N#C[C@]1(NC(=O)CCc2cc(F)ccc2F)CCSC1 |
| InChI | InChI=1S/C14H14F2N2OS/c15-11-2-3-12(16)10(7-11)1-4-13(19)18-14(8-17)5-6-20-9-14/h2-3,7H,1,4-6,9H2,(H,18,19)/t14-/m1/s1 |
| InChIKey | UBBXCVVKRJAYEG-CQSZACIVSA-N |
| XLogP | 2.41 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |