C12H10BrFN2OS — CID 54877568
2-bromo-N-(3-cyanothiolan-3-yl)-5-fluorobenzamide (PubChem CID 54877568) has the molecular formula C12H10BrFN2OS and a molecular weight of 329.19 g/mol. Its IUPAC name is 2-bromo-N-(3-cyanothiolan-3-yl)-5-fluorobenzamide.
| Compound Name | 2-bromo-N-(3-cyanothiolan-3-yl)-5-fluorobenzamide |
|---|---|
| PubChem CID | 54877568 |
| Molecular Formula | C12H10BrFN2OS |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | 2-bromo-N-(3-cyanothiolan-3-yl)-5-fluorobenzamide |
| SMILES | N#CC1(NC(=O)c2cc(F)ccc2Br)CCSC1 |
| InChI | InChI=1S/C12H10BrFN2OS/c13-10-2-1-8(14)5-9(10)11(17)16-12(6-15)3-4-18-7-12/h1-2,5H,3-4,7H2,(H,16,17) |
| InChIKey | KGJIVMLBQAQBSI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |