C11H9Cl2N3OS — CID 103772029
2,6-dichloro-N-(3-cyanothiolan-3-yl)pyridine-3-carboxamide (PubChem CID 103772029) has the molecular formula C11H9Cl2N3OS and a molecular weight of 302.19 g/mol. Its IUPAC name is 2,6-dichloro-N-(3-cyanothiolan-3-yl)pyridine-3-carboxamide.
| Compound Name | 2,6-dichloro-N-(3-cyanothiolan-3-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103772029 |
| Molecular Formula | C11H9Cl2N3OS |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | 2,6-dichloro-N-(3-cyanothiolan-3-yl)pyridine-3-carboxamide |
| SMILES | N#CC1(NC(=O)c2ccc(Cl)nc2Cl)CCSC1 |
| InChI | InChI=1S/C11H9Cl2N3OS/c12-8-2-1-7(9(13)15-8)10(17)16-11(5-14)3-4-18-6-11/h1-2H,3-4,6H2,(H,16,17) |
| InChIKey | ZZQLNIFAJGWWMU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|