C16H15N3O2S — CID 71984945
N-(3-cyanothiolan-3-yl)-2-(5-phenyl-1,2-oxazol-3-yl)acetamide (PubChem CID 71984945) has the molecular formula C16H15N3O2S and a molecular weight of 313.38 g/mol. Its IUPAC name is N-(3-cyanothiolan-3-yl)-2-(5-phenyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | N-(3-cyanothiolan-3-yl)-2-(5-phenyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 71984945 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | N-(3-cyanothiolan-3-yl)-2-(5-phenyl-1,2-oxazol-3-yl)acetamide |
| SMILES | N#CC1(NC(=O)Cc2cc(-c3ccccc3)on2)CCSC1 |
| InChI | InChI=1S/C16H15N3O2S/c17-10-16(6-7-22-11-16)18-15(20)9-13-8-14(21-19-13)12-4-2-1-3-5-12/h1-5,8H,6-7,9,11H2,(H,18,20) |
| InChIKey | WCQQYKHECZTAFT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |