C19H24N2O3 — CID 111538994
N-[(1-hydroxycycloheptyl)methyl]-2-(5-phenyl-1,2-oxazol-3-yl)acetamide (PubChem CID 111538994) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is N-[(1-hydroxycycloheptyl)methyl]-2-(5-phenyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | N-[(1-hydroxycycloheptyl)methyl]-2-(5-phenyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 111538994 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-[(1-hydroxycycloheptyl)methyl]-2-(5-phenyl-1,2-oxazol-3-yl)acetamide |
| SMILES | O=C(Cc1cc(-c2ccccc2)on1)NCC1(O)CCCCCC1 |
| InChI | InChI=1S/C19H24N2O3/c22-18(20-14-19(23)10-6-1-2-7-11-19)13-16-12-17(24-21-16)15-8-4-3-5-9-15/h3-5,8-9,12,23H,1-2,6-7,10-11,13-14H2,(H,20,22) |
| InChIKey | PMXALGITZYPFBP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |