C16H20N2O3 — CID 110619673
N-(4-methoxybutyl)-2-(5-phenyl-1,2-oxazol-3-yl)acetamide (PubChem CID 110619673) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is N-(4-methoxybutyl)-2-(5-phenyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | N-(4-methoxybutyl)-2-(5-phenyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 110619673 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N-(4-methoxybutyl)-2-(5-phenyl-1,2-oxazol-3-yl)acetamide |
| SMILES | COCCCCNC(=O)Cc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C16H20N2O3/c1-20-10-6-5-9-17-16(19)12-14-11-15(21-18-14)13-7-3-2-4-8-13/h2-4,7-8,11H,5-6,9-10,12H2,1H3,(H,17,19) |
| InChIKey | IDECHPBCCDDXJR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|