C20H28N2O3 — CID 16879241
2-[5-(4-methoxyphenyl)-1,2-oxazol-3-yl]-N-octylacetamide (PubChem CID 16879241) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-[5-(4-methoxyphenyl)-1,2-oxazol-3-yl]-N-octylacetamide.
| Compound Name | 2-[5-(4-methoxyphenyl)-1,2-oxazol-3-yl]-N-octylacetamide |
|---|---|
| PubChem CID | 16879241 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 2-[5-(4-methoxyphenyl)-1,2-oxazol-3-yl]-N-octylacetamide |
| SMILES | CCCCCCCCNC(=O)Cc1cc(-c2ccc(OC)cc2)on1 |
| InChI | InChI=1S/C20H28N2O3/c1-3-4-5-6-7-8-13-21-20(23)15-17-14-19(25-22-17)16-9-11-18(24-2)12-10-16/h9-12,14H,3-8,13,15H2,1-2H3,(H,21,23) |
| InChIKey | LKAVEXZCHFVEKX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|