C15H16N2O3 — CID 16879106
2-[5-(4-methoxyphenyl)-1,2-oxazol-3-yl]-N-prop-2-enylacetamide (PubChem CID 16879106) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-[5-(4-methoxyphenyl)-1,2-oxazol-3-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[5-(4-methoxyphenyl)-1,2-oxazol-3-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 16879106 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-[5-(4-methoxyphenyl)-1,2-oxazol-3-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)Cc1cc(-c2ccc(OC)cc2)on1 |
| InChI | InChI=1S/C15H16N2O3/c1-3-8-16-15(18)10-12-9-14(20-17-12)11-4-6-13(19-2)7-5-11/h3-7,9H,1,8,10H2,2H3,(H,16,18) |
| InChIKey | PCISBTYLAWFDNI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|