C17H21N3O4 — CID 110313759
N-(3-acetamidopropyl)-2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]acetamide (PubChem CID 110313759) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is N-(3-acetamidopropyl)-2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]acetamide.
| Compound Name | N-(3-acetamidopropyl)-2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]acetamide |
|---|---|
| PubChem CID | 110313759 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N-(3-acetamidopropyl)-2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]acetamide |
| SMILES | COc1cccc(-c2cc(CC(=O)NCCCNC(C)=O)no2)c1 |
| InChI | InChI=1S/C17H21N3O4/c1-12(21)18-7-4-8-19-17(22)11-14-10-16(24-20-14)13-5-3-6-15(9-13)23-2/h3,5-6,9-10H,4,7-8,11H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | PBJZRUUJKKJHAA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|