C24H20N2O4 — CID 16879011
2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]-N-(4-phenoxyphenyl)acetamide (PubChem CID 16879011) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is 2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 16879011 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]-N-(4-phenoxyphenyl)acetamide |
| SMILES | COc1cccc(-c2cc(CC(=O)Nc3ccc(Oc4ccccc4)cc3)no2)c1 |
| InChI | InChI=1S/C24H20N2O4/c1-28-22-9-5-6-17(14-22)23-15-19(26-30-23)16-24(27)25-18-10-12-21(13-11-18)29-20-7-3-2-4-8-20/h2-15H,16H2,1H3,(H,25,27) |
| InChIKey | RUGQNSYVONNKBY-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |