C20H18N2O4 — CID 16879006
N-(3-acetylphenyl)-2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]acetamide (PubChem CID 16879006) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]acetamide.
| Compound Name | N-(3-acetylphenyl)-2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]acetamide |
|---|---|
| PubChem CID | 16879006 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-(3-acetylphenyl)-2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]acetamide |
| SMILES | COc1cccc(-c2cc(CC(=O)Nc3cccc(C(C)=O)c3)no2)c1 |
| InChI | InChI=1S/C20H18N2O4/c1-13(23)14-5-3-7-16(9-14)21-20(24)12-17-11-19(26-22-17)15-6-4-8-18(10-15)25-2/h3-11H,12H2,1-2H3,(H,21,24) |
| InChIKey | KZIPQGGZSGJHAT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |