C16H15N3O2S — CID 110313138
2-(5-phenyl-1,2-oxazol-3-yl)-N-[2-(1,3-thiazol-4-yl)ethyl]acetamide (PubChem CID 110313138) has the molecular formula C16H15N3O2S and a molecular weight of 313.38 g/mol. Its IUPAC name is 2-(5-phenyl-1,2-oxazol-3-yl)-N-[2-(1,3-thiazol-4-yl)ethyl]acetamide.
| Compound Name | 2-(5-phenyl-1,2-oxazol-3-yl)-N-[2-(1,3-thiazol-4-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 110313138 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-(5-phenyl-1,2-oxazol-3-yl)-N-[2-(1,3-thiazol-4-yl)ethyl]acetamide |
| SMILES | O=C(Cc1cc(-c2ccccc2)on1)NCCc1cscn1 |
| InChI | InChI=1S/C16H15N3O2S/c20-16(17-7-6-13-10-22-11-18-13)9-14-8-15(21-19-14)12-4-2-1-3-5-12/h1-5,8,10-11H,6-7,9H2,(H,17,20) |
| InChIKey | DENMCPXFIPFOAS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |