C20H20N2O4 — CID 110314664
2-(2-methoxyphenoxy)-N-[2-(5-phenyl-1,2-oxazol-3-yl)ethyl]acetamide (PubChem CID 110314664) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-(2-methoxyphenoxy)-N-[2-(5-phenyl-1,2-oxazol-3-yl)ethyl]acetamide.
| Compound Name | 2-(2-methoxyphenoxy)-N-[2-(5-phenyl-1,2-oxazol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 110314664 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-(2-methoxyphenoxy)-N-[2-(5-phenyl-1,2-oxazol-3-yl)ethyl]acetamide |
| SMILES | COc1ccccc1OCC(=O)NCCc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C20H20N2O4/c1-24-17-9-5-6-10-18(17)25-14-20(23)21-12-11-16-13-19(26-22-16)15-7-3-2-4-8-15/h2-10,13H,11-12,14H2,1H3,(H,21,23) |
| InChIKey | FJWFSZGMUFQSTC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |