C16H18N2O4 — CID 71788624
N-[(4-hydroxyoxan-4-yl)methyl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 71788624) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is N-[(4-hydroxyoxan-4-yl)methyl]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[(4-hydroxyoxan-4-yl)methyl]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 71788624 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N-[(4-hydroxyoxan-4-yl)methyl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCC1(O)CCOCC1)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C16H18N2O4/c19-15(17-11-16(20)6-8-21-9-7-16)13-10-14(22-18-13)12-4-2-1-3-5-12/h1-5,10,20H,6-9,11H2,(H,17,19) |
| InChIKey | KQUCEKJMSZCXOE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |