C16H18N2O3S — CID 111486579
N-[(4-hydroxythian-4-yl)methyl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 111486579) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is N-[(4-hydroxythian-4-yl)methyl]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[(4-hydroxythian-4-yl)methyl]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 111486579 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | N-[(4-hydroxythian-4-yl)methyl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCC1(O)CCSCC1)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C16H18N2O3S/c19-15(17-11-16(20)6-8-22-9-7-16)13-10-14(21-18-13)12-4-2-1-3-5-12/h1-5,10,20H,6-9,11H2,(H,17,19) |
| InChIKey | DEEONKJWRJVZRN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |