C19H18N2O3 — CID 110001753
N-[(1S)-2-hydroxy-1-phenylethyl]-2-(5-phenyl-1,2-oxazol-3-yl)acetamide (PubChem CID 110001753) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is N-[(1S)-2-hydroxy-1-phenylethyl]-2-(5-phenyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | N-[(1S)-2-hydroxy-1-phenylethyl]-2-(5-phenyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 110001753 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-[(1S)-2-hydroxy-1-phenylethyl]-2-(5-phenyl-1,2-oxazol-3-yl)acetamide |
| SMILES | O=C(Cc1cc(-c2ccccc2)on1)N[C@H](CO)c1ccccc1 |
| InChI | InChI=1S/C19H18N2O3/c22-13-17(14-7-3-1-4-8-14)20-19(23)12-16-11-18(24-21-16)15-9-5-2-6-10-15/h1-11,17,22H,12-13H2,(H,20,23)/t17-/m1/s1 |
| InChIKey | HYUCKWRDIIWTRV-QGZVFWFLSA-N |
| XLogP | 2.73 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |