C15H18N2O2 — CID 16878276
N-butan-2-yl-2-(5-phenyl-1,2-oxazol-3-yl)acetamide (PubChem CID 16878276) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is N-butan-2-yl-2-(5-phenyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | N-butan-2-yl-2-(5-phenyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 16878276 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | N-butan-2-yl-2-(5-phenyl-1,2-oxazol-3-yl)acetamide |
| SMILES | CCC(C)NC(=O)Cc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C15H18N2O2/c1-3-11(2)16-15(18)10-13-9-14(19-17-13)12-7-5-4-6-8-12/h4-9,11H,3,10H2,1-2H3,(H,16,18) |
| InChIKey | RMXMGRFOCDPCMZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |