C16H20ClNO3 — CID 120530949
1-[[4-(4-chlorophenyl)-3-methylbutanoyl]amino]cyclobutane-1-carboxylic acid (PubChem CID 120530949) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is 1-[[4-(4-chlorophenyl)-3-methylbutanoyl]amino]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[[4-(4-chlorophenyl)-3-methylbutanoyl]amino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120530949 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 1-[[4-(4-chlorophenyl)-3-methylbutanoyl]amino]cyclobutane-1-carboxylic acid |
| SMILES | CC(CC(=O)NC1(C(=O)O)CCC1)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClNO3/c1-11(9-12-3-5-13(17)6-4-12)10-14(19)18-16(15(20)21)7-2-8-16/h3-6,11H,2,7-10H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | LUMQDRZWYSFHLM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |