C19H22ClNO — CID 2857117
4-(4-chlorophenyl)-N-(2,5-dimethylphenyl)-3-methylbutanamide (PubChem CID 2857117) has the molecular formula C19H22ClNO and a molecular weight of 315.84 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(2,5-dimethylphenyl)-3-methylbutanamide.
| Compound Name | 4-(4-chlorophenyl)-N-(2,5-dimethylphenyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 2857117 |
| Molecular Formula | C19H22ClNO |
| Molecular Weight | 315.84 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(2,5-dimethylphenyl)-3-methylbutanamide |
| SMILES | Cc1ccc(C)c(NC(=O)CC(C)Cc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H22ClNO/c1-13-4-5-15(3)18(11-13)21-19(22)12-14(2)10-16-6-8-17(20)9-7-16/h4-9,11,14H,10,12H2,1-3H3,(H,21,22) |
| InChIKey | XBPGRJCBWOBCSI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.84 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |