C19H20NO3- — CID 7787033
(2S)-2-benzyl-4-(2,5-dimethylanilino)-4-oxobutanoate (PubChem CID 7787033) has the molecular formula C19H20NO3- and a molecular weight of 310.37 g/mol. Its IUPAC name is (2S)-2-benzyl-4-(2,5-dimethylanilino)-4-oxobutanoate.
| Compound Name | (2S)-2-benzyl-4-(2,5-dimethylanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 7787033 |
| Molecular Formula | C19H20NO3- |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (2S)-2-benzyl-4-(2,5-dimethylanilino)-4-oxobutanoate |
| SMILES | Cc1ccc(C)c(NC(=O)C[C@H](Cc2ccccc2)C(=O)[O-])c1 |
| InChI | InChI=1S/C19H21NO3/c1-13-8-9-14(2)17(10-13)20-18(21)12-16(19(22)23)11-15-6-4-3-5-7-15/h3-10,16H,11-12H2,1-2H3,(H,20,21)(H,22,23)/p-1/t16-/m0/s1 |
| InChIKey | UQQQUOPKAOSXDB-INIZCTEOSA-M |
| XLogP | 2.24 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |