C18H21NOS — CID 8797847
3-benzylsulfanyl-N-(2,5-dimethylphenyl)propanamide (PubChem CID 8797847) has the molecular formula C18H21NOS and a molecular weight of 299.44 g/mol. Its IUPAC name is 3-benzylsulfanyl-N-(2,5-dimethylphenyl)propanamide.
| Compound Name | 3-benzylsulfanyl-N-(2,5-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 8797847 |
| Molecular Formula | C18H21NOS |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 3-benzylsulfanyl-N-(2,5-dimethylphenyl)propanamide |
| SMILES | Cc1ccc(C)c(NC(=O)CCSCc2ccccc2)c1 |
| InChI | InChI=1S/C18H21NOS/c1-14-8-9-15(2)17(12-14)19-18(20)10-11-21-13-16-6-4-3-5-7-16/h3-9,12H,10-11,13H2,1-2H3,(H,19,20) |
| InChIKey | NUMUHSHNRZJODR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|