C21H26N2O5 — CID 171154393
3-[benzyl(methyl)amino]-N-(2,5-dimethylphenyl)propanamide;oxalic acid (PubChem CID 171154393) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is 3-[benzyl(methyl)amino]-N-(2,5-dimethylphenyl)propanamide;oxalic acid.
| Compound Name | 3-[benzyl(methyl)amino]-N-(2,5-dimethylphenyl)propanamide;oxalic acid |
|---|---|
| PubChem CID | 171154393 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 3-[benzyl(methyl)amino]-N-(2,5-dimethylphenyl)propanamide;oxalic acid |
| SMILES | Cc1ccc(C)c(NC(=O)CCN(C)Cc2ccccc2)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H24N2O.C2H2O4/c1-15-9-10-16(2)18(13-15)20-19(22)11-12-21(3)14-17-7-5-4-6-8-17;3-1(4)2(5)6/h4-10,13H,11-12,14H2,1-3H3,(H,20,22);(H,3,4)(H,5,6) |
| InChIKey | ZNPFNULRLUOXEH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|