C18H20N2O2 — CID 108953156
N-(2,5-dimethylphenyl)-N'-methyl-N'-phenylpropanediamide (PubChem CID 108953156) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-N'-methyl-N'-phenylpropanediamide.
| Compound Name | N-(2,5-dimethylphenyl)-N'-methyl-N'-phenylpropanediamide |
|---|---|
| PubChem CID | 108953156 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N-(2,5-dimethylphenyl)-N'-methyl-N'-phenylpropanediamide |
| SMILES | Cc1ccc(C)c(NC(=O)CC(=O)N(C)c2ccccc2)c1 |
| InChI | InChI=1S/C18H20N2O2/c1-13-9-10-14(2)16(11-13)19-17(21)12-18(22)20(3)15-7-5-4-6-8-15/h4-11H,12H2,1-3H3,(H,19,21) |
| InChIKey | IOYYISKGRGMMJL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|