C16H15ClN2O2 — CID 108953174
N-(2-chlorophenyl)-N'-methyl-N'-phenylpropanediamide (PubChem CID 108953174) has the molecular formula C16H15ClN2O2 and a molecular weight of 302.76 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N'-methyl-N'-phenylpropanediamide.
| Compound Name | N-(2-chlorophenyl)-N'-methyl-N'-phenylpropanediamide |
|---|---|
| PubChem CID | 108953174 |
| Molecular Formula | C16H15ClN2O2 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | N-(2-chlorophenyl)-N'-methyl-N'-phenylpropanediamide |
| SMILES | CN(C(=O)CC(=O)Nc1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C16H15ClN2O2/c1-19(12-7-3-2-4-8-12)16(21)11-15(20)18-14-10-6-5-9-13(14)17/h2-10H,11H2,1H3,(H,18,20) |
| InChIKey | NRVVWYDYIWPTGP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|