C13H14ClNO3S — CID 65452594
1-[3-(4-chlorophenyl)sulfanylpropanoylamino]cyclopropane-1-carboxylic acid (PubChem CID 65452594) has the molecular formula C13H14ClNO3S and a molecular weight of 299.78 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)sulfanylpropanoylamino]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[3-(4-chlorophenyl)sulfanylpropanoylamino]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 65452594 |
| Molecular Formula | C13H14ClNO3S |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 1-[3-(4-chlorophenyl)sulfanylpropanoylamino]cyclopropane-1-carboxylic acid |
| SMILES | O=C(CCSc1ccc(Cl)cc1)NC1(C(=O)O)CC1 |
| InChI | InChI=1S/C13H14ClNO3S/c14-9-1-3-10(4-2-9)19-8-5-11(16)15-13(6-7-13)12(17)18/h1-4H,5-8H2,(H,15,16)(H,17,18) |
| InChIKey | SUWAXWMSLRFDOL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |