C12H14ClNO2S — CID 115877823
2-(4-chlorophenyl)sulfanyl-N-[1-(hydroxymethyl)cyclopropyl]acetamide (PubChem CID 115877823) has the molecular formula C12H14ClNO2S and a molecular weight of 271.77 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[1-(hydroxymethyl)cyclopropyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[1-(hydroxymethyl)cyclopropyl]acetamide |
|---|---|
| PubChem CID | 115877823 |
| Molecular Formula | C12H14ClNO2S |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[1-(hydroxymethyl)cyclopropyl]acetamide |
| SMILES | O=C(CSc1ccc(Cl)cc1)NC1(CO)CC1 |
| InChI | InChI=1S/C12H14ClNO2S/c13-9-1-3-10(4-2-9)17-7-11(16)14-12(8-15)5-6-12/h1-4,15H,5-8H2,(H,14,16) |
| InChIKey | QJRJOYQEQOZITM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |