C10H10ClNO3S — CID 676713
2-[[2-(4-chlorophenyl)sulfanylacetyl]amino]acetic acid (PubChem CID 676713) has the molecular formula C10H10ClNO3S and a molecular weight of 259.71 g/mol. Its IUPAC name is 2-[[2-(4-chlorophenyl)sulfanylacetyl]amino]acetic acid.
| Compound Name | 2-[[2-(4-chlorophenyl)sulfanylacetyl]amino]acetic acid |
|---|---|
| PubChem CID | 676713 |
| Molecular Formula | C10H10ClNO3S |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | 2-[[2-(4-chlorophenyl)sulfanylacetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H10ClNO3S/c11-7-1-3-8(4-2-7)16-6-9(13)12-5-10(14)15/h1-4H,5-6H2,(H,12,13)(H,14,15) |
| InChIKey | OFCFMEUPIHMGJB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |