C15H20ClNO2S — CID 62518929
2-[(4-chlorophenyl)methylsulfanyl]-N-[1-(hydroxymethyl)cyclopentyl]acetamide (PubChem CID 62518929) has the molecular formula C15H20ClNO2S and a molecular weight of 313.85 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanyl]-N-[1-(hydroxymethyl)cyclopentyl]acetamide.
| Compound Name | 2-[(4-chlorophenyl)methylsulfanyl]-N-[1-(hydroxymethyl)cyclopentyl]acetamide |
|---|---|
| PubChem CID | 62518929 |
| Molecular Formula | C15H20ClNO2S |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanyl]-N-[1-(hydroxymethyl)cyclopentyl]acetamide |
| SMILES | O=C(CSCc1ccc(Cl)cc1)NC1(CO)CCCC1 |
| InChI | InChI=1S/C15H20ClNO2S/c16-13-5-3-12(4-6-13)9-20-10-14(19)17-15(11-18)7-1-2-8-15/h3-6,18H,1-2,7-11H2,(H,17,19) |
| InChIKey | VTAVROQSYPQSIS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |