C17H25NO2S — CID 62521811
N-[1-(hydroxymethyl)cyclohexyl]-2-(2-phenylethylsulfanyl)acetamide (PubChem CID 62521811) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is N-[1-(hydroxymethyl)cyclohexyl]-2-(2-phenylethylsulfanyl)acetamide.
| Compound Name | N-[1-(hydroxymethyl)cyclohexyl]-2-(2-phenylethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 62521811 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | N-[1-(hydroxymethyl)cyclohexyl]-2-(2-phenylethylsulfanyl)acetamide |
| SMILES | O=C(CSCCc1ccccc1)NC1(CO)CCCCC1 |
| InChI | InChI=1S/C17H25NO2S/c19-14-17(10-5-2-6-11-17)18-16(20)13-21-12-9-15-7-3-1-4-8-15/h1,3-4,7-8,19H,2,5-6,9-14H2,(H,18,20) |
| InChIKey | GMTMGGQDUIVCAV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|