C15H21FN2O2 — CID 115683138
1-(3-fluorophenyl)-3-[[1-(hydroxymethyl)cyclohexyl]methyl]urea (PubChem CID 115683138) has the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[[1-(hydroxymethyl)cyclohexyl]methyl]urea.
| Compound Name | 1-(3-fluorophenyl)-3-[[1-(hydroxymethyl)cyclohexyl]methyl]urea |
|---|---|
| PubChem CID | 115683138 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[[1-(hydroxymethyl)cyclohexyl]methyl]urea |
| SMILES | O=C(NCC1(CO)CCCCC1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C15H21FN2O2/c16-12-5-4-6-13(9-12)18-14(20)17-10-15(11-19)7-2-1-3-8-15/h4-6,9,19H,1-3,7-8,10-11H2,(H2,17,18,20) |
| InChIKey | FBFWYTYZZZBEPW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |