C18H27NO3S — CID 111538834
N-[3-(tert-butylsulfinylmethyl)phenyl]-2-(1-hydroxycyclopentyl)acetamide (PubChem CID 111538834) has the molecular formula C18H27NO3S and a molecular weight of 337.48 g/mol. Its IUPAC name is N-[3-(tert-butylsulfinylmethyl)phenyl]-2-(1-hydroxycyclopentyl)acetamide.
| Compound Name | N-[3-(tert-butylsulfinylmethyl)phenyl]-2-(1-hydroxycyclopentyl)acetamide |
|---|---|
| PubChem CID | 111538834 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.48 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | N-[3-(tert-butylsulfinylmethyl)phenyl]-2-(1-hydroxycyclopentyl)acetamide |
| SMILES | CC(C)(C)S(=O)Cc1cccc(NC(=O)CC2(O)CCCC2)c1 |
| InChI | InChI=1S/C18H27NO3S/c1-17(2,3)23(22)13-14-7-6-8-15(11-14)19-16(20)12-18(21)9-4-5-10-18/h6-8,11,21H,4-5,9-10,12-13H2,1-3H3,(H,19,20) |
| InChIKey | JTDJKBPKFUVTAX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |