C17H26N2O2S — CID 95629055
1-[3-[[(R)-tert-butylsulfinyl]methyl]phenyl]-3-[(1R)-1-cyclopropylethyl]urea (PubChem CID 95629055) has the molecular formula C17H26N2O2S and a molecular weight of 322.47 g/mol. Its IUPAC name is 1-[3-[[(R)-tert-butylsulfinyl]methyl]phenyl]-3-[(1R)-1-cyclopropylethyl]urea.
| Compound Name | 1-[3-[[(R)-tert-butylsulfinyl]methyl]phenyl]-3-[(1R)-1-cyclopropylethyl]urea |
|---|---|
| PubChem CID | 95629055 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1-[3-[[(R)-tert-butylsulfinyl]methyl]phenyl]-3-[(1R)-1-cyclopropylethyl]urea |
| SMILES | C[C@@H](NC(=O)Nc1cccc(C[S@@](=O)C(C)(C)C)c1)C1CC1 |
| InChI | InChI=1S/C17H26N2O2S/c1-12(14-8-9-14)18-16(20)19-15-7-5-6-13(10-15)11-22(21)17(2,3)4/h5-7,10,12,14H,8-9,11H2,1-4H3,(H2,18,19,20)/t12-,22-/m1/s1 |
| InChIKey | DQJTWPMDLIJDDX-VERVWZFWSA-N |
| XLogP | 3.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |