C16H22N4O2S — CID 99835815
1-[3-[[(S)-tert-butylsulfinyl]methyl]phenyl]-3-(5-methyl-1H-pyrazol-3-yl)urea (PubChem CID 99835815) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is 1-[3-[[(S)-tert-butylsulfinyl]methyl]phenyl]-3-(5-methyl-1H-pyrazol-3-yl)urea.
| Compound Name | 1-[3-[[(S)-tert-butylsulfinyl]methyl]phenyl]-3-(5-methyl-1H-pyrazol-3-yl)urea |
|---|---|
| PubChem CID | 99835815 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-[3-[[(S)-tert-butylsulfinyl]methyl]phenyl]-3-(5-methyl-1H-pyrazol-3-yl)urea |
| SMILES | Cc1cc(NC(=O)Nc2cccc(C[S@](=O)C(C)(C)C)c2)n[nH]1 |
| InChI | InChI=1S/C16H22N4O2S/c1-11-8-14(20-19-11)18-15(21)17-13-7-5-6-12(9-13)10-23(22)16(2,3)4/h5-9H,10H2,1-4H3,(H3,17,18,19,20,21)/t23-/m0/s1 |
| InChIKey | ZOWYDULIGXOYHQ-QHCPKHFHSA-N |
| XLogP | 3.41 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |