C19H25ClN2O2S — CID 119789984
2-(4-aminophenyl)-N-[3-(tert-butylsulfinylmethyl)phenyl]acetamide;hydrochloride (PubChem CID 119789984) has the molecular formula C19H25ClN2O2S and a molecular weight of 380.94 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[3-(tert-butylsulfinylmethyl)phenyl]acetamide;hydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-[3-(tert-butylsulfinylmethyl)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119789984 |
| Molecular Formula | C19H25ClN2O2S |
| Molecular Weight | 380.94 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 2-(4-aminophenyl)-N-[3-(tert-butylsulfinylmethyl)phenyl]acetamide;hydrochloride |
| SMILES | CC(C)(C)S(=O)Cc1cccc(NC(=O)Cc2ccc(N)cc2)c1.Cl |
| InChI | InChI=1S/C19H24N2O2S.ClH/c1-19(2,3)24(23)13-15-5-4-6-17(11-15)21-18(22)12-14-7-9-16(20)10-8-14;/h4-11H,12-13,20H2,1-3H3,(H,21,22);1H |
| InChIKey | RXCGCDRBSDOSAR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.94 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|